C15H17NO3 — CID 115276986
2-(1-benzofuran-3-yl)-1-(3-hydroxypiperidin-1-yl)ethanone (PubChem CID 115276986) has the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. Its IUPAC name is 2-(1-benzofuran-3-yl)-1-(3-hydroxypiperidin-1-yl)ethanone.
| Compound Name | 2-(1-benzofuran-3-yl)-1-(3-hydroxypiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 115276986 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 2-(1-benzofuran-3-yl)-1-(3-hydroxypiperidin-1-yl)ethanone |
| SMILES | O=C(Cc1coc2ccccc12)N1CCCC(O)C1 |
| InChI | InChI=1S/C15H17NO3/c17-12-4-3-7-16(9-12)15(18)8-11-10-19-14-6-2-1-5-13(11)14/h1-2,5-6,10,12,17H,3-4,7-9H2 |
| InChIKey | GNPYETCCIYRRPD-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |