About (3S)-1-(1,2,4-oxadiazol-5-ylmethyl)pyrrolidin-3-ol
(3S)-1-(1,2,4-oxadiazol-5-ylmethyl)pyrrolidin-3-ol (PubChem CID 115277620) has the molecular formula C7H11N3O2
and a molecular weight of 169.18 g/mol. Its IUPAC name is (3S)-1-(1,2,4-oxadiazol-5-ylmethyl)pyrrolidin-3-ol.
Molecular Properties
| Compound Name | (3S)-1-(1,2,4-oxadiazol-5-ylmethyl)pyrrolidin-3-ol |
| PubChem CID | 115277620 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | (3S)-1-(1,2,4-oxadiazol-5-ylmethyl)pyrrolidin-3-ol |
| SMILES | O[C@H]1CCN(Cc2ncno2)C1 |
| InChI | InChI=1S/C7H11N3O2/c11-6-1-2-10(3-6)4-7-8-5-9-12-7/h5-6,11H,1-4H2/t6-/m0/s1 |
| InChIKey | BXMWJUJPAORTMG-LURJTMIESA-N |
| XLogP | -0.36 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3S)-1-(1,2,4-oxadiazol-5-ylmethyl)pyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1-(1,2,4-oxadiazol-5-ylmethyl)pyrrolidin-3-ol?
The IUPAC name of (3S)-1-(1,2,4-oxadiazol-5-ylmethyl)pyrrolidin-3-ol (CID 115277620) is (3S)-1-(1,2,4-oxadiazol-5-ylmethyl)pyrrolidin-3-ol.
What is the SMILES notation for (3S)-1-(1,2,4-oxadiazol-5-ylmethyl)pyrrolidin-3-ol?
The canonical SMILES for (3S)-1-(1,2,4-oxadiazol-5-ylmethyl)pyrrolidin-3-ol is O[C@H]1CCN(Cc2ncno2)C1.
What is the InChIKey of (3S)-1-(1,2,4-oxadiazol-5-ylmethyl)pyrrolidin-3-ol?
The InChIKey is BXMWJUJPAORTMG-LURJTMIESA-N. The full InChI is InChI=1S/C7H11N3O2/c11-6-1-2-10(3-6)4-7-8-5-9-12-7/h5-6,11H,1-4H2/t6-/m0/s1.
What are the key properties of (3S)-1-(1,2,4-oxadiazol-5-ylmethyl)pyrrolidin-3-ol?
(3S)-1-(1,2,4-oxadiazol-5-ylmethyl)pyrrolidin-3-ol has a molecular weight of 169.18 g/mol, XLogP of -0.36, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-(1,2,4-oxadiazol-5-ylmethyl)pyrrolidin-3-ol is sourced from PubChem (CID 115277620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).