C11H16N4 — CID 115277807
4-(5-cyclopropyl-2-methyl-1,2,4-triazol-3-yl)cyclopent-2-en-1-amine (PubChem CID 115277807) has the molecular formula C11H16N4 and a molecular weight of 204.28 g/mol. Its IUPAC name is 4-(5-cyclopropyl-2-methyl-1,2,4-triazol-3-yl)cyclopent-2-en-1-amine.
| Compound Name | 4-(5-cyclopropyl-2-methyl-1,2,4-triazol-3-yl)cyclopent-2-en-1-amine |
|---|---|
| PubChem CID | 115277807 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 4-(5-cyclopropyl-2-methyl-1,2,4-triazol-3-yl)cyclopent-2-en-1-amine |
| SMILES | Cn1nc(C2CC2)nc1C1C=CC(N)C1 |
| InChI | InChI=1S/C11H16N4/c1-15-11(8-4-5-9(12)6-8)13-10(14-15)7-2-3-7/h4-5,7-9H,2-3,6,12H2,1H3 |
| InChIKey | YTAKNGWYXPTDBG-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|