C9H17NO3S — CID 115277838
3-propan-2-yl-3,4,4a,5,7,7a-hexahydro-2H-thieno[3,4-b][1,4]oxazine 6,6-dioxide (PubChem CID 115277838) has the molecular formula C9H17NO3S and a molecular weight of 219.31 g/mol. Its IUPAC name is 3-propan-2-yl-3,4,4a,5,7,7a-hexahydro-2H-thieno[3,4-b][1,4]oxazine 6,6-dioxide.
| Compound Name | 3-propan-2-yl-3,4,4a,5,7,7a-hexahydro-2H-thieno[3,4-b][1,4]oxazine 6,6-dioxide |
|---|---|
| PubChem CID | 115277838 |
| Molecular Formula | C9H17NO3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 3-propan-2-yl-3,4,4a,5,7,7a-hexahydro-2H-thieno[3,4-b][1,4]oxazine 6,6-dioxide |
| SMILES | CC(C)C1COC2CS(=O)(=O)CC2N1 |
| InChI | InChI=1S/C9H17NO3S/c1-6(2)7-3-13-9-5-14(11,12)4-8(9)10-7/h6-10H,3-5H2,1-2H3 |
| InChIKey | GEFOJQHJWVXNBN-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |