C8H14N4 — CID 115277885
N-[(2,5-dimethyl-1,2,4-triazol-3-yl)methyl]prop-2-en-1-amine (PubChem CID 115277885) has the molecular formula C8H14N4 and a molecular weight of 166.23 g/mol. Its IUPAC name is N-[(2,5-dimethyl-1,2,4-triazol-3-yl)methyl]prop-2-en-1-amine.
| Compound Name | N-[(2,5-dimethyl-1,2,4-triazol-3-yl)methyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 115277885 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | N-[(2,5-dimethyl-1,2,4-triazol-3-yl)methyl]prop-2-en-1-amine |
| SMILES | C=CCNCc1nc(C)nn1C |
| InChI | InChI=1S/C8H14N4/c1-4-5-9-6-8-10-7(2)11-12(8)3/h4,9H,1,5-6H2,2-3H3 |
| InChIKey | RKHGDYNVHBDNCF-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|