C13H20N6 — CID 115278225
6-(5-tert-butyl-2-methyl-1,2,4-triazol-3-yl)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine (PubChem CID 115278225) has the molecular formula C13H20N6 and a molecular weight of 260.34 g/mol. Its IUPAC name is 6-(5-tert-butyl-2-methyl-1,2,4-triazol-3-yl)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine.
| Compound Name | 6-(5-tert-butyl-2-methyl-1,2,4-triazol-3-yl)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 115278225 |
| Molecular Formula | C13H20N6 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | 6-(5-tert-butyl-2-methyl-1,2,4-triazol-3-yl)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine |
| SMILES | Cn1nc(C(C)(C)C)nc1C1Cc2nc[nH]c2CN1 |
| InChI | InChI=1S/C13H20N6/c1-13(2,3)12-17-11(19(4)18-12)9-5-8-10(6-14-9)16-7-15-8/h7,9,14H,5-6H2,1-4H3,(H,15,16) |
| InChIKey | CPCGONXOGKVVBU-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |