C9H15N3O2 — CID 115278412
(3R,4S)-1-(2-pyrazol-1-ylethyl)pyrrolidine-3,4-diol (PubChem CID 115278412) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is (3R,4S)-1-(2-pyrazol-1-ylethyl)pyrrolidine-3,4-diol.
| Compound Name | (3R,4S)-1-(2-pyrazol-1-ylethyl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 115278412 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | (3R,4S)-1-(2-pyrazol-1-ylethyl)pyrrolidine-3,4-diol |
| SMILES | O[C@@H]1CN(CCn2cccn2)C[C@@H]1O |
| InChI | InChI=1S/C9H15N3O2/c13-8-6-11(7-9(8)14)4-5-12-3-1-2-10-12/h1-3,8-9,13-14H,4-7H2/t8-,9+ |
| InChIKey | UYWBZMHIZBNRTM-DTORHVGOSA-N |
| XLogP | -1.08 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |