C10H20N2O3 — CID 115278442
(3R,4S)-1-[(4-methylmorpholin-2-yl)methyl]pyrrolidine-3,4-diol (PubChem CID 115278442) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is (3R,4S)-1-[(4-methylmorpholin-2-yl)methyl]pyrrolidine-3,4-diol.
| Compound Name | (3R,4S)-1-[(4-methylmorpholin-2-yl)methyl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 115278442 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | (3R,4S)-1-[(4-methylmorpholin-2-yl)methyl]pyrrolidine-3,4-diol |
| SMILES | CN1CCOC(CN2C[C@@H](O)[C@@H](O)C2)C1 |
| InChI | InChI=1S/C10H20N2O3/c1-11-2-3-15-8(4-11)5-12-6-9(13)10(14)7-12/h8-10,13-14H,2-7H2,1H3/t8?,9-,10+ |
| InChIKey | XJOXPJPUPGPPKF-PBINXNQUSA-N |
| XLogP | -1.65 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |