About 5-(2-bromophenyl)-2-(1,4-dioxan-2-yl)-4-hydroxy-1H-pyrimidin-6-one
5-(2-bromophenyl)-2-(1,4-dioxan-2-yl)-4-hydroxy-1H-pyrimidin-6-one (PubChem CID 115278470) has the molecular formula C14H13BrN2O4
and a molecular weight of 353.17 g/mol. Its IUPAC name is 5-(2-bromophenyl)-2-(1,4-dioxan-2-yl)-4-hydroxy-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 5-(2-bromophenyl)-2-(1,4-dioxan-2-yl)-4-hydroxy-1H-pyrimidin-6-one |
| PubChem CID | 115278470 |
| Molecular Formula | C14H13BrN2O4 |
| Molecular Weight | 353.17 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | 5-(2-bromophenyl)-2-(1,4-dioxan-2-yl)-4-hydroxy-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(C2COCCO2)nc(O)c1-c1ccccc1Br |
| InChI | InChI=1S/C14H13BrN2O4/c15-9-4-2-1-3-8(9)11-13(18)16-12(17-14(11)19)10-7-20-5-6-21-10/h1-4,10H,5-7H2,(H2,16,17,18,19) |
| InChIKey | YAODZRLSVOAGML-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.17 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(2-bromophenyl)-2-(1,4-dioxan-2-yl)-4-hydroxy-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-bromophenyl)-2-(1,4-dioxan-2-yl)-4-hydroxy-1H-pyrimidin-6-one?
The IUPAC name of 5-(2-bromophenyl)-2-(1,4-dioxan-2-yl)-4-hydroxy-1H-pyrimidin-6-one (CID 115278470) is 5-(2-bromophenyl)-2-(1,4-dioxan-2-yl)-4-hydroxy-1H-pyrimidin-6-one.
What is the SMILES notation for 5-(2-bromophenyl)-2-(1,4-dioxan-2-yl)-4-hydroxy-1H-pyrimidin-6-one?
The canonical SMILES for 5-(2-bromophenyl)-2-(1,4-dioxan-2-yl)-4-hydroxy-1H-pyrimidin-6-one is O=c1[nH]c(C2COCCO2)nc(O)c1-c1ccccc1Br.
What is the InChIKey of 5-(2-bromophenyl)-2-(1,4-dioxan-2-yl)-4-hydroxy-1H-pyrimidin-6-one?
The InChIKey is YAODZRLSVOAGML-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13BrN2O4/c15-9-4-2-1-3-8(9)11-13(18)16-12(17-14(11)19)10-7-20-5-6-21-10/h1-4,10H,5-7H2,(H2,16,17,18,19).
What are the key properties of 5-(2-bromophenyl)-2-(1,4-dioxan-2-yl)-4-hydroxy-1H-pyrimidin-6-one?
5-(2-bromophenyl)-2-(1,4-dioxan-2-yl)-4-hydroxy-1H-pyrimidin-6-one has a molecular weight of 353.17 g/mol, XLogP of 1.99, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-bromophenyl)-2-(1,4-dioxan-2-yl)-4-hydroxy-1H-pyrimidin-6-one is sourced from PubChem (CID 115278470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).