C52H73NO4 — CID 11527884
11,17,23-tritert-butyl-25,26,27,28-tetrapropoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaen-5-amine (PubChem CID 11527884) has the molecular formula C52H73NO4 and a molecular weight of 776.16 g/mol. Its IUPAC name is 11,17,23-tritert-butyl-25,26,27,28-tetrapropoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaen-5-amine.
| Compound Name | 11,17,23-tritert-butyl-25,26,27,28-tetrapropoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaen-5-amine |
|---|---|
| PubChem CID | 11527884 |
| Molecular Formula | C52H73NO4 |
| Molecular Weight | 776.16 g/mol |
| Exact Mass | 775.55 |
| IUPAC Name | 11,17,23-tritert-butyl-25,26,27,28-tetrapropoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaen-5-amine |
| SMILES | CCCOc1c2cc(N)cc1Cc1cc(C(C)(C)C)cc(c1OCCC)Cc1cc(C(C)(C)C)cc(c1OCCC)Cc1cc(C(C)(C)C)cc(c1OCCC)C2 |
| InChI | InChI=1S/C52H73NO4/c1-14-18-54-46-34-22-36-28-43(51(8,9)10)30-38(47(36)55-19-15-2)24-40-32-45(53)33-41(49(40)57-21-17-4)25-39-31-44(52(11,12)13)29-37(48(39)56-20-16-3)23-35(46)27-42(26-34)50(5,6)7/h26-33H,14-25,53H2,1-13H3 |
| InChIKey | OMYNMNQRTKIBNA-UHFFFAOYSA-N |
| XLogP | 12.99 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.16 |
| LogP ≤ 5 | 12.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|