C10H11ClN4 — CID 115280256
2-(4-chlorophthalazin-1-yl)-1,1-dimethylhydrazine (PubChem CID 115280256) has the molecular formula C10H11ClN4 and a molecular weight of 222.68 g/mol. Its IUPAC name is 2-(4-chlorophthalazin-1-yl)-1,1-dimethylhydrazine.
| Compound Name | 2-(4-chlorophthalazin-1-yl)-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 115280256 |
| Molecular Formula | C10H11ClN4 |
| Molecular Weight | 222.68 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 2-(4-chlorophthalazin-1-yl)-1,1-dimethylhydrazine |
| SMILES | CN(C)Nc1nnc(Cl)c2ccccc12 |
| InChI | InChI=1S/C10H11ClN4/c1-15(2)14-10-8-6-4-3-5-7(8)9(11)12-13-10/h3-6H,1-2H3,(H,13,14) |
| InChIKey | WTFOPTREIVHYSP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.68 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|