About N-(1-amino-2,3-dimethylbutan-2-yl)hexa-2,4-dienamide
N-(1-amino-2,3-dimethylbutan-2-yl)hexa-2,4-dienamide (PubChem CID 115282583) has the molecular formula C12H22N2O
and a molecular weight of 210.32 g/mol. Its IUPAC name is N-(1-amino-2,3-dimethylbutan-2-yl)hexa-2,4-dienamide.
Molecular Properties
| Compound Name | N-(1-amino-2,3-dimethylbutan-2-yl)hexa-2,4-dienamide |
| PubChem CID | 115282583 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | N-(1-amino-2,3-dimethylbutan-2-yl)hexa-2,4-dienamide |
| SMILES | CC=CC=CC(=O)NC(C)(CN)C(C)C |
| InChI | InChI=1S/C12H22N2O/c1-5-6-7-8-11(15)14-12(4,9-13)10(2)3/h5-8,10H,9,13H2,1-4H3,(H,14,15) |
| InChIKey | OWSBUZLBALOJMH-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-(1-amino-2,3-dimethylbutan-2-yl)hexa-2,4-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-amino-2,3-dimethylbutan-2-yl)hexa-2,4-dienamide?
The IUPAC name of N-(1-amino-2,3-dimethylbutan-2-yl)hexa-2,4-dienamide (CID 115282583) is N-(1-amino-2,3-dimethylbutan-2-yl)hexa-2,4-dienamide.
What is the SMILES notation for N-(1-amino-2,3-dimethylbutan-2-yl)hexa-2,4-dienamide?
The canonical SMILES for N-(1-amino-2,3-dimethylbutan-2-yl)hexa-2,4-dienamide is CC=CC=CC(=O)NC(C)(CN)C(C)C.
What is the InChIKey of N-(1-amino-2,3-dimethylbutan-2-yl)hexa-2,4-dienamide?
The InChIKey is OWSBUZLBALOJMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O/c1-5-6-7-8-11(15)14-12(4,9-13)10(2)3/h5-8,10H,9,13H2,1-4H3,(H,14,15).
What are the key properties of N-(1-amino-2,3-dimethylbutan-2-yl)hexa-2,4-dienamide?
N-(1-amino-2,3-dimethylbutan-2-yl)hexa-2,4-dienamide has a molecular weight of 210.32 g/mol, XLogP of 1.61, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-amino-2,3-dimethylbutan-2-yl)hexa-2,4-dienamide is sourced from PubChem (CID 115282583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).