About 2-hydroxypropylurea
2-hydroxypropylurea (PubChem CID 11528340) has the molecular formula C4H10N2O2
and a molecular weight of 118.14 g/mol. Its IUPAC name is 2-hydroxypropylurea.
Molecular Properties
| Compound Name | 2-hydroxypropylurea |
| PubChem CID | 11528340 |
| Molecular Formula | C4H10N2O2 |
| Molecular Weight | 118.14 g/mol |
| Exact Mass | 118.07 |
| IUPAC Name | 2-hydroxypropylurea |
| SMILES | CC(O)CNC(N)=O |
| InChI | InChI=1S/C4H10N2O2/c1-3(7)2-6-4(5)8/h3,7H,2H2,1H3,(H3,5,6,8) |
| InChIKey | VHEYHMGSWDZXEN-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.14 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-hydroxypropylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypropylurea?
The IUPAC name of 2-hydroxypropylurea (CID 11528340) is 2-hydroxypropylurea.
What is the SMILES notation for 2-hydroxypropylurea?
The canonical SMILES for 2-hydroxypropylurea is CC(O)CNC(N)=O.
What is the InChIKey of 2-hydroxypropylurea?
The InChIKey is VHEYHMGSWDZXEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2O2/c1-3(7)2-6-4(5)8/h3,7H,2H2,1H3,(H3,5,6,8).
What are the key properties of 2-hydroxypropylurea?
2-hydroxypropylurea has a molecular weight of 118.14 g/mol, XLogP of -0.96, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypropylurea is sourced from PubChem (CID 11528340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).