C12H18N2O5S2 — CID 115283908
2-[2-(propylsulfonylamino)propanoylamino]-2-thiophen-2-ylacetic acid (PubChem CID 115283908) has the molecular formula C12H18N2O5S2 and a molecular weight of 334.42 g/mol. Its IUPAC name is 2-[2-(propylsulfonylamino)propanoylamino]-2-thiophen-2-ylacetic acid.
| Compound Name | 2-[2-(propylsulfonylamino)propanoylamino]-2-thiophen-2-ylacetic acid |
|---|---|
| PubChem CID | 115283908 |
| Molecular Formula | C12H18N2O5S2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 2-[2-(propylsulfonylamino)propanoylamino]-2-thiophen-2-ylacetic acid |
| SMILES | CCCS(=O)(=O)NC(C)C(=O)NC(C(=O)O)c1cccs1 |
| InChI | InChI=1S/C12H18N2O5S2/c1-3-7-21(18,19)14-8(2)11(15)13-10(12(16)17)9-5-4-6-20-9/h4-6,8,10,14H,3,7H2,1-2H3,(H,13,15)(H,16,17) |
| InChIKey | VWRNCJVRSWJJLL-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |