C11H12F3NO4S — CID 115284099
2-thiophen-2-yl-2-[3-(2,2,2-trifluoroethoxy)propanoylamino]acetic acid (PubChem CID 115284099) has the molecular formula C11H12F3NO4S and a molecular weight of 311.28 g/mol. Its IUPAC name is 2-thiophen-2-yl-2-[3-(2,2,2-trifluoroethoxy)propanoylamino]acetic acid.
| Compound Name | 2-thiophen-2-yl-2-[3-(2,2,2-trifluoroethoxy)propanoylamino]acetic acid |
|---|---|
| PubChem CID | 115284099 |
| Molecular Formula | C11H12F3NO4S |
| Molecular Weight | 311.28 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 2-thiophen-2-yl-2-[3-(2,2,2-trifluoroethoxy)propanoylamino]acetic acid |
| SMILES | O=C(CCOCC(F)(F)F)NC(C(=O)O)c1cccs1 |
| InChI | InChI=1S/C11H12F3NO4S/c12-11(13,14)6-19-4-3-8(16)15-9(10(17)18)7-2-1-5-20-7/h1-2,5,9H,3-4,6H2,(H,15,16)(H,17,18) |
| InChIKey | PMFYITVBDCWJAE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|