C14H12FNO4S — CID 115284111
2-[[2-(4-fluorophenoxy)acetyl]amino]-2-thiophen-2-ylacetic acid (PubChem CID 115284111) has the molecular formula C14H12FNO4S and a molecular weight of 309.32 g/mol. Its IUPAC name is 2-[[2-(4-fluorophenoxy)acetyl]amino]-2-thiophen-2-ylacetic acid.
| Compound Name | 2-[[2-(4-fluorophenoxy)acetyl]amino]-2-thiophen-2-ylacetic acid |
|---|---|
| PubChem CID | 115284111 |
| Molecular Formula | C14H12FNO4S |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 2-[[2-(4-fluorophenoxy)acetyl]amino]-2-thiophen-2-ylacetic acid |
| SMILES | O=C(COc1ccc(F)cc1)NC(C(=O)O)c1cccs1 |
| InChI | InChI=1S/C14H12FNO4S/c15-9-3-5-10(6-4-9)20-8-12(17)16-13(14(18)19)11-2-1-7-21-11/h1-7,13H,8H2,(H,16,17)(H,18,19) |
| InChIKey | NSGUOSBALHXBJV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |