About 3-phenyl-4,5-dihydro-1H-pyridazine-6-thione
3-phenyl-4,5-dihydro-1H-pyridazine-6-thione (PubChem CID 11528493) has the molecular formula C10H10N2S
and a molecular weight of 190.27 g/mol. Its IUPAC name is 3-phenyl-4,5-dihydro-1H-pyridazine-6-thione.
Molecular Properties
| Compound Name | 3-phenyl-4,5-dihydro-1H-pyridazine-6-thione |
| PubChem CID | 11528493 |
| Molecular Formula | C10H10N2S |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 3-phenyl-4,5-dihydro-1H-pyridazine-6-thione |
| SMILES | S=C1CCC(c2ccccc2)=NN1 |
| InChI | InChI=1S/C10H10N2S/c13-10-7-6-9(11-12-10)8-4-2-1-3-5-8/h1-5H,6-7H2,(H,12,13) |
| InChIKey | IKJXCMQSYYZDIQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-phenyl-4,5-dihydro-1H-pyridazine-6-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-4,5-dihydro-1H-pyridazine-6-thione?
The IUPAC name of 3-phenyl-4,5-dihydro-1H-pyridazine-6-thione (CID 11528493) is 3-phenyl-4,5-dihydro-1H-pyridazine-6-thione.
What is the SMILES notation for 3-phenyl-4,5-dihydro-1H-pyridazine-6-thione?
The canonical SMILES for 3-phenyl-4,5-dihydro-1H-pyridazine-6-thione is S=C1CCC(c2ccccc2)=NN1.
What is the InChIKey of 3-phenyl-4,5-dihydro-1H-pyridazine-6-thione?
The InChIKey is IKJXCMQSYYZDIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2S/c13-10-7-6-9(11-12-10)8-4-2-1-3-5-8/h1-5H,6-7H2,(H,12,13).
What are the key properties of 3-phenyl-4,5-dihydro-1H-pyridazine-6-thione?
3-phenyl-4,5-dihydro-1H-pyridazine-6-thione has a molecular weight of 190.27 g/mol, XLogP of 2.10, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-4,5-dihydro-1H-pyridazine-6-thione is sourced from PubChem (CID 11528493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).