C12H10N2S — CID 11528610
4-(1H-indol-3-ylmethyl)-1,3-thiazole (PubChem CID 11528610) has the molecular formula C12H10N2S and a molecular weight of 214.29 g/mol. Its IUPAC name is 4-(1H-indol-3-ylmethyl)-1,3-thiazole.
| Compound Name | 4-(1H-indol-3-ylmethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 11528610 |
| Molecular Formula | C12H10N2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 4-(1H-indol-3-ylmethyl)-1,3-thiazole |
| SMILES | c1ccc2c(Cc3cscn3)c[nH]c2c1 |
| InChI | InChI=1S/C12H10N2S/c1-2-4-12-11(3-1)9(6-13-12)5-10-7-15-8-14-10/h1-4,6-8,13H,5H2 |
| InChIKey | TYYYCBLSBXONAF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |