C11H14N4OS — CID 115287266
2-amino-N-[(1-methylimidazol-2-yl)methyl]-2-thiophen-2-ylacetamide (PubChem CID 115287266) has the molecular formula C11H14N4OS and a molecular weight of 250.33 g/mol. Its IUPAC name is 2-amino-N-[(1-methylimidazol-2-yl)methyl]-2-thiophen-2-ylacetamide.
| Compound Name | 2-amino-N-[(1-methylimidazol-2-yl)methyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 115287266 |
| Molecular Formula | C11H14N4OS |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 2-amino-N-[(1-methylimidazol-2-yl)methyl]-2-thiophen-2-ylacetamide |
| SMILES | Cn1ccnc1CNC(=O)C(N)c1cccs1 |
| InChI | InChI=1S/C11H14N4OS/c1-15-5-4-13-9(15)7-14-11(16)10(12)8-3-2-6-17-8/h2-6,10H,7,12H2,1H3,(H,14,16) |
| InChIKey | YFUWHFIMXZGYLS-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |