About ethyl 2-[(1R,2S,3S)-3-hydroxy-2-[(1S)-1-hydroxyethyl]cyclohexyl]acetate
ethyl 2-[(1R,2S,3S)-3-hydroxy-2-[(1S)-1-hydroxyethyl]cyclohexyl]acetate (PubChem CID 11528739) has the molecular formula C12H22O4
and a molecular weight of 230.30 g/mol. Its IUPAC name is ethyl 2-[(1R,2S,3S)-3-hydroxy-2-[(1S)-1-hydroxyethyl]cyclohexyl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[(1R,2S,3S)-3-hydroxy-2-[(1S)-1-hydroxyethyl]cyclohexyl]acetate |
| PubChem CID | 11528739 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | ethyl 2-[(1R,2S,3S)-3-hydroxy-2-[(1S)-1-hydroxyethyl]cyclohexyl]acetate |
| SMILES | CCOC(=O)C[C@H]1CCC[C@H](O)[C@@H]1[C@H](C)O |
| InChI | InChI=1S/C12H22O4/c1-3-16-11(15)7-9-5-4-6-10(14)12(9)8(2)13/h8-10,12-14H,3-7H2,1-2H3/t8-,9+,10-,12+/m0/s1 |
| InChIKey | UMXRXVMMEDHTNP-MIZYBKAJSA-N |
| XLogP | 1.10 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-[(1R,2S,3S)-3-hydroxy-2-[(1S)-1-hydroxyethyl]cyclohexyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(1R,2S,3S)-3-hydroxy-2-[(1S)-1-hydroxyethyl]cyclohexyl]acetate?
The IUPAC name of ethyl 2-[(1R,2S,3S)-3-hydroxy-2-[(1S)-1-hydroxyethyl]cyclohexyl]acetate (CID 11528739) is ethyl 2-[(1R,2S,3S)-3-hydroxy-2-[(1S)-1-hydroxyethyl]cyclohexyl]acetate.
What is the SMILES notation for ethyl 2-[(1R,2S,3S)-3-hydroxy-2-[(1S)-1-hydroxyethyl]cyclohexyl]acetate?
The canonical SMILES for ethyl 2-[(1R,2S,3S)-3-hydroxy-2-[(1S)-1-hydroxyethyl]cyclohexyl]acetate is CCOC(=O)C[C@H]1CCC[C@H](O)[C@@H]1[C@H](C)O.
What is the InChIKey of ethyl 2-[(1R,2S,3S)-3-hydroxy-2-[(1S)-1-hydroxyethyl]cyclohexyl]acetate?
The InChIKey is UMXRXVMMEDHTNP-MIZYBKAJSA-N. The full InChI is InChI=1S/C12H22O4/c1-3-16-11(15)7-9-5-4-6-10(14)12(9)8(2)13/h8-10,12-14H,3-7H2,1-2H3/t8-,9+,10-,12+/m0/s1.
What are the key properties of ethyl 2-[(1R,2S,3S)-3-hydroxy-2-[(1S)-1-hydroxyethyl]cyclohexyl]acetate?
ethyl 2-[(1R,2S,3S)-3-hydroxy-2-[(1S)-1-hydroxyethyl]cyclohexyl]acetate has a molecular weight of 230.30 g/mol, XLogP of 1.10, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(1R,2S,3S)-3-hydroxy-2-[(1S)-1-hydroxyethyl]cyclohexyl]acetate is sourced from PubChem (CID 11528739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).