C13H12ClN3O3S — CID 115288197
2-[[(E)-3-(5-chlorothiophen-2-yl)prop-2-enoyl]amino]-2-(1-methylpyrazol-4-yl)acetic acid (PubChem CID 115288197) has the molecular formula C13H12ClN3O3S and a molecular weight of 325.78 g/mol. Its IUPAC name is 2-[[(E)-3-(5-chlorothiophen-2-yl)prop-2-enoyl]amino]-2-(1-methylpyrazol-4-yl)acetic acid.
| Compound Name | 2-[[(E)-3-(5-chlorothiophen-2-yl)prop-2-enoyl]amino]-2-(1-methylpyrazol-4-yl)acetic acid |
|---|---|
| PubChem CID | 115288197 |
| Molecular Formula | C13H12ClN3O3S |
| Molecular Weight | 325.78 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | 2-[[(E)-3-(5-chlorothiophen-2-yl)prop-2-enoyl]amino]-2-(1-methylpyrazol-4-yl)acetic acid |
| SMILES | Cn1cc(C(NC(=O)/C=C/c2ccc(Cl)s2)C(=O)O)cn1 |
| InChI | InChI=1S/C13H12ClN3O3S/c1-17-7-8(6-15-17)12(13(19)20)16-11(18)5-3-9-2-4-10(14)21-9/h2-7,12H,1H3,(H,16,18)(H,19,20)/b5-3+ |
| InChIKey | VOEQINGFYCMHLB-HWKANZROSA-N |
| XLogP | 2.09 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.78 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|