C16H24O2 — CID 11528903
(4aS)-3,5,5,8-tetramethylspiro[1,2,4a,7-tetrahydronaphthalene-6,2'-1,3-dioxolane] (PubChem CID 11528903) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (4aS)-3,5,5,8-tetramethylspiro[1,2,4a,7-tetrahydronaphthalene-6,2'-1,3-dioxolane].
| Compound Name | (4aS)-3,5,5,8-tetramethylspiro[1,2,4a,7-tetrahydronaphthalene-6,2'-1,3-dioxolane] |
|---|---|
| PubChem CID | 11528903 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (4aS)-3,5,5,8-tetramethylspiro[1,2,4a,7-tetrahydronaphthalene-6,2'-1,3-dioxolane] |
| SMILES | CC1=C[C@H]2C(=C(C)CC3(OCCO3)C2(C)C)CC1 |
| InChI | InChI=1S/C16H24O2/c1-11-5-6-13-12(2)10-16(17-7-8-18-16)15(3,4)14(13)9-11/h9,14H,5-8,10H2,1-4H3/t14-/m0/s1 |
| InChIKey | QTMNOVMXUKQJBW-AWEZNQCLSA-N |
| XLogP | 3.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|