C12H20N4O5 — CID 115289236
2-[2-(2-methoxyethoxy)ethylcarbamoylamino]-2-(1-methylpyrazol-4-yl)acetic acid (PubChem CID 115289236) has the molecular formula C12H20N4O5 and a molecular weight of 300.32 g/mol. Its IUPAC name is 2-[2-(2-methoxyethoxy)ethylcarbamoylamino]-2-(1-methylpyrazol-4-yl)acetic acid.
| Compound Name | 2-[2-(2-methoxyethoxy)ethylcarbamoylamino]-2-(1-methylpyrazol-4-yl)acetic acid |
|---|---|
| PubChem CID | 115289236 |
| Molecular Formula | C12H20N4O5 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 2-[2-(2-methoxyethoxy)ethylcarbamoylamino]-2-(1-methylpyrazol-4-yl)acetic acid |
| SMILES | COCCOCCNC(=O)NC(C(=O)O)c1cnn(C)c1 |
| InChI | InChI=1S/C12H20N4O5/c1-16-8-9(7-14-16)10(11(17)18)15-12(19)13-3-4-21-6-5-20-2/h7-8,10H,3-6H2,1-2H3,(H,17,18)(H2,13,15,19) |
| InChIKey | OBOXZALUYOPXCX-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|