C13H17NO4 — CID 11528936
methyl (1R,4R,5S)-4-but-3-enyl-3-oxo-2-oxa-8-azabicyclo[3.3.1]non-6-ene-8-carboxylate (PubChem CID 11528936) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is methyl (1R,4R,5S)-4-but-3-enyl-3-oxo-2-oxa-8-azabicyclo[3.3.1]non-6-ene-8-carboxylate.
| Compound Name | methyl (1R,4R,5S)-4-but-3-enyl-3-oxo-2-oxa-8-azabicyclo[3.3.1]non-6-ene-8-carboxylate |
|---|---|
| PubChem CID | 11528936 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | methyl (1R,4R,5S)-4-but-3-enyl-3-oxo-2-oxa-8-azabicyclo[3.3.1]non-6-ene-8-carboxylate |
| SMILES | C=CCC[C@H]1C(=O)O[C@@H]2C[C@H]1C=CN2C(=O)OC |
| InChI | InChI=1S/C13H17NO4/c1-3-4-5-10-9-6-7-14(13(16)17-2)11(8-9)18-12(10)15/h3,6-7,9-11H,1,4-5,8H2,2H3/t9-,10-,11-/m1/s1 |
| InChIKey | YQSMAFRWCBUUNT-GMTAPVOTSA-N |
| XLogP | 2.05 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|