C12H15BrN4OS — CID 115290169
2-amino-N-[(4-bromothiophen-2-yl)methyl]-N-methyl-2-(1-methylpyrazol-4-yl)acetamide (PubChem CID 115290169) has the molecular formula C12H15BrN4OS and a molecular weight of 343.25 g/mol. Its IUPAC name is 2-amino-N-[(4-bromothiophen-2-yl)methyl]-N-methyl-2-(1-methylpyrazol-4-yl)acetamide.
| Compound Name | 2-amino-N-[(4-bromothiophen-2-yl)methyl]-N-methyl-2-(1-methylpyrazol-4-yl)acetamide |
|---|---|
| PubChem CID | 115290169 |
| Molecular Formula | C12H15BrN4OS |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | 2-amino-N-[(4-bromothiophen-2-yl)methyl]-N-methyl-2-(1-methylpyrazol-4-yl)acetamide |
| SMILES | CN(Cc1cc(Br)cs1)C(=O)C(N)c1cnn(C)c1 |
| InChI | InChI=1S/C12H15BrN4OS/c1-16(6-10-3-9(13)7-19-10)12(18)11(14)8-4-15-17(2)5-8/h3-5,7,11H,6,14H2,1-2H3 |
| InChIKey | RATCMRQWJGWEIZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |