C13H14N4O4 — CID 115290303
5-[[2-amino-2-(1-methylpyrazol-4-yl)acetyl]amino]-2-hydroxybenzoic acid (PubChem CID 115290303) has the molecular formula C13H14N4O4 and a molecular weight of 290.28 g/mol. Its IUPAC name is 5-[[2-amino-2-(1-methylpyrazol-4-yl)acetyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 5-[[2-amino-2-(1-methylpyrazol-4-yl)acetyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 115290303 |
| Molecular Formula | C13H14N4O4 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 5-[[2-amino-2-(1-methylpyrazol-4-yl)acetyl]amino]-2-hydroxybenzoic acid |
| SMILES | Cn1cc(C(N)C(=O)Nc2ccc(O)c(C(=O)O)c2)cn1 |
| InChI | InChI=1S/C13H14N4O4/c1-17-6-7(5-15-17)11(14)12(19)16-8-2-3-10(18)9(4-8)13(20)21/h2-6,11,18H,14H2,1H3,(H,16,19)(H,20,21) |
| InChIKey | SWNHPLCJPXJFTE-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|