C12H20N4O3 — CID 115290306
6-[[2-amino-2-(1-methylpyrazol-4-yl)acetyl]amino]hexanoic acid (PubChem CID 115290306) has the molecular formula C12H20N4O3 and a molecular weight of 268.32 g/mol. Its IUPAC name is 6-[[2-amino-2-(1-methylpyrazol-4-yl)acetyl]amino]hexanoic acid.
| Compound Name | 6-[[2-amino-2-(1-methylpyrazol-4-yl)acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 115290306 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 6-[[2-amino-2-(1-methylpyrazol-4-yl)acetyl]amino]hexanoic acid |
| SMILES | Cn1cc(C(N)C(=O)NCCCCCC(=O)O)cn1 |
| InChI | InChI=1S/C12H20N4O3/c1-16-8-9(7-15-16)11(13)12(19)14-6-4-2-3-5-10(17)18/h7-8,11H,2-6,13H2,1H3,(H,14,19)(H,17,18) |
| InChIKey | WHLCIELEUSAXIH-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|