C13H16N2O4S — CID 115291414
4-[[(E)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoyl]amino]oxane-4-carboxylic acid (PubChem CID 115291414) has the molecular formula C13H16N2O4S and a molecular weight of 296.35 g/mol. Its IUPAC name is 4-[[(E)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoyl]amino]oxane-4-carboxylic acid.
| Compound Name | 4-[[(E)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoyl]amino]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 115291414 |
| Molecular Formula | C13H16N2O4S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 4-[[(E)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoyl]amino]oxane-4-carboxylic acid |
| SMILES | Cc1nc(/C=C/C(=O)NC2(C(=O)O)CCOCC2)cs1 |
| InChI | InChI=1S/C13H16N2O4S/c1-9-14-10(8-20-9)2-3-11(16)15-13(12(17)18)4-6-19-7-5-13/h2-3,8H,4-7H2,1H3,(H,15,16)(H,17,18)/b3-2+ |
| InChIKey | HBGGVAILUAKITO-NSCUHMNNSA-N |
| XLogP | 1.21 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|