C12H15N3O6 — CID 115291609
4-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]oxane-4-carboxylic acid (PubChem CID 115291609) has the molecular formula C12H15N3O6 and a molecular weight of 297.27 g/mol. Its IUPAC name is 4-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]oxane-4-carboxylic acid.
| Compound Name | 4-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 115291609 |
| Molecular Formula | C12H15N3O6 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 4-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]oxane-4-carboxylic acid |
| SMILES | O=C(Cn1ccc(=O)[nH]c1=O)NC1(C(=O)O)CCOCC1 |
| InChI | InChI=1S/C12H15N3O6/c16-8-1-4-15(11(20)13-8)7-9(17)14-12(10(18)19)2-5-21-6-3-12/h1,4H,2-3,5-7H2,(H,14,17)(H,18,19)(H,13,16,20) |
| InChIKey | DKVMPLMUQVMYII-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 130.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |