C13H18N2O6 — CID 115291678
4-[3-(2,5-dioxopyrrolidin-1-yl)propanoylamino]oxane-4-carboxylic acid (PubChem CID 115291678) has the molecular formula C13H18N2O6 and a molecular weight of 298.30 g/mol. Its IUPAC name is 4-[3-(2,5-dioxopyrrolidin-1-yl)propanoylamino]oxane-4-carboxylic acid.
| Compound Name | 4-[3-(2,5-dioxopyrrolidin-1-yl)propanoylamino]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 115291678 |
| Molecular Formula | C13H18N2O6 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 4-[3-(2,5-dioxopyrrolidin-1-yl)propanoylamino]oxane-4-carboxylic acid |
| SMILES | O=C(CCN1C(=O)CCC1=O)NC1(C(=O)O)CCOCC1 |
| InChI | InChI=1S/C13H18N2O6/c16-9(3-6-15-10(17)1-2-11(15)18)14-13(12(19)20)4-7-21-8-5-13/h1-8H2,(H,14,16)(H,19,20) |
| InChIKey | VCMKHMQKHDTCCK-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|