C18H21NO2 — CID 11529297
(3E,4aS,5S)-5-hydroxy-1,4a-dimethyl-3-(pyridin-3-ylmethylidene)-5,6,7,8-tetrahydro-4H-naphthalen-2-one (PubChem CID 11529297) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is (3E,4aS,5S)-5-hydroxy-1,4a-dimethyl-3-(pyridin-3-ylmethylidene)-5,6,7,8-tetrahydro-4H-naphthalen-2-one.
| Compound Name | (3E,4aS,5S)-5-hydroxy-1,4a-dimethyl-3-(pyridin-3-ylmethylidene)-5,6,7,8-tetrahydro-4H-naphthalen-2-one |
|---|---|
| PubChem CID | 11529297 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | (3E,4aS,5S)-5-hydroxy-1,4a-dimethyl-3-(pyridin-3-ylmethylidene)-5,6,7,8-tetrahydro-4H-naphthalen-2-one |
| SMILES | CC1=C2CCC[C@H](O)[C@@]2(C)C/C(=C\c2cccnc2)C1=O |
| InChI | InChI=1S/C18H21NO2/c1-12-15-6-3-7-16(20)18(15,2)10-14(17(12)21)9-13-5-4-8-19-11-13/h4-5,8-9,11,16,20H,3,6-7,10H2,1-2H3/b14-9+/t16-,18-/m0/s1 |
| InChIKey | DJDXYNDMCPXJJP-AOXAOBTDSA-N |
| XLogP | 3.31 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|