C16H20N4O — CID 11529314
N-[[(1S,8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl]imidazo[1,2-a]pyridine-8-carboxamide (PubChem CID 11529314) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is N-[[(1S,8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl]imidazo[1,2-a]pyridine-8-carboxamide.
| Compound Name | N-[[(1S,8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl]imidazo[1,2-a]pyridine-8-carboxamide |
|---|---|
| PubChem CID | 11529314 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | N-[[(1S,8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl]imidazo[1,2-a]pyridine-8-carboxamide |
| SMILES | O=C(NC[C@@H]1CCN2CCC[C@@H]12)c1cccn2ccnc12 |
| InChI | InChI=1S/C16H20N4O/c21-16(13-3-1-8-20-10-6-17-15(13)20)18-11-12-5-9-19-7-2-4-14(12)19/h1,3,6,8,10,12,14H,2,4-5,7,9,11H2,(H,18,21)/t12-,14-/m0/s1 |
| InChIKey | VOQXWJLOFPGUHP-JSGCOSHPSA-N |
| XLogP | 1.55 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |