C13H23N3O4 — CID 115293156
4-[[3-(dimethylamino)pyrrolidine-1-carbonyl]amino]oxane-4-carboxylic acid (PubChem CID 115293156) has the molecular formula C13H23N3O4 and a molecular weight of 285.34 g/mol. Its IUPAC name is 4-[[3-(dimethylamino)pyrrolidine-1-carbonyl]amino]oxane-4-carboxylic acid.
| Compound Name | 4-[[3-(dimethylamino)pyrrolidine-1-carbonyl]amino]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 115293156 |
| Molecular Formula | C13H23N3O4 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 4-[[3-(dimethylamino)pyrrolidine-1-carbonyl]amino]oxane-4-carboxylic acid |
| SMILES | CN(C)C1CCN(C(=O)NC2(C(=O)O)CCOCC2)C1 |
| InChI | InChI=1S/C13H23N3O4/c1-15(2)10-3-6-16(9-10)12(19)14-13(11(17)18)4-7-20-8-5-13/h10H,3-9H2,1-2H3,(H,14,19)(H,17,18) |
| InChIKey | RUCPUSLNVJIIIL-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |