About 4-[4-(2-methylpropyl)-1,2,4-triazol-3-yl]oxan-4-amine
4-[4-(2-methylpropyl)-1,2,4-triazol-3-yl]oxan-4-amine (PubChem CID 115293386) has the molecular formula C11H20N4O
and a molecular weight of 224.31 g/mol. Its IUPAC name is 4-[4-(2-methylpropyl)-1,2,4-triazol-3-yl]oxan-4-amine.
Molecular Properties
| Compound Name | 4-[4-(2-methylpropyl)-1,2,4-triazol-3-yl]oxan-4-amine |
| PubChem CID | 115293386 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 4-[4-(2-methylpropyl)-1,2,4-triazol-3-yl]oxan-4-amine |
| SMILES | CC(C)Cn1cnnc1C1(N)CCOCC1 |
| InChI | InChI=1S/C11H20N4O/c1-9(2)7-15-8-13-14-10(15)11(12)3-5-16-6-4-11/h8-9H,3-7,12H2,1-2H3 |
| InChIKey | OXAYJZHSKIBWQA-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[4-(2-methylpropyl)-1,2,4-triazol-3-yl]oxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(2-methylpropyl)-1,2,4-triazol-3-yl]oxan-4-amine?
The IUPAC name of 4-[4-(2-methylpropyl)-1,2,4-triazol-3-yl]oxan-4-amine (CID 115293386) is 4-[4-(2-methylpropyl)-1,2,4-triazol-3-yl]oxan-4-amine.
What is the SMILES notation for 4-[4-(2-methylpropyl)-1,2,4-triazol-3-yl]oxan-4-amine?
The canonical SMILES for 4-[4-(2-methylpropyl)-1,2,4-triazol-3-yl]oxan-4-amine is CC(C)Cn1cnnc1C1(N)CCOCC1.
What is the InChIKey of 4-[4-(2-methylpropyl)-1,2,4-triazol-3-yl]oxan-4-amine?
The InChIKey is OXAYJZHSKIBWQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4O/c1-9(2)7-15-8-13-14-10(15)11(12)3-5-16-6-4-11/h8-9H,3-7,12H2,1-2H3.
What are the key properties of 4-[4-(2-methylpropyl)-1,2,4-triazol-3-yl]oxan-4-amine?
4-[4-(2-methylpropyl)-1,2,4-triazol-3-yl]oxan-4-amine has a molecular weight of 224.31 g/mol, XLogP of 0.90, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(2-methylpropyl)-1,2,4-triazol-3-yl]oxan-4-amine is sourced from PubChem (CID 115293386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).