C14H22O6 — CID 11529345
[(2S,3R,4R,4aS,7R,8S,8aS)-3-hydroxy-2,4,7,8a-tetramethyl-6-oxo-2,3,4,4a,7,8-hexahydropyrano[3,2-b]pyran-8-yl] acetate (PubChem CID 11529345) has the molecular formula C14H22O6 and a molecular weight of 286.32 g/mol. Its IUPAC name is [(2S,3R,4R,4aS,7R,8S,8aS)-3-hydroxy-2,4,7,8a-tetramethyl-6-oxo-2,3,4,4a,7,8-hexahydropyrano[3,2-b]pyran-8-yl] acetate.
| Compound Name | [(2S,3R,4R,4aS,7R,8S,8aS)-3-hydroxy-2,4,7,8a-tetramethyl-6-oxo-2,3,4,4a,7,8-hexahydropyrano[3,2-b]pyran-8-yl] acetate |
|---|---|
| PubChem CID | 11529345 |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | [(2S,3R,4R,4aS,7R,8S,8aS)-3-hydroxy-2,4,7,8a-tetramethyl-6-oxo-2,3,4,4a,7,8-hexahydropyrano[3,2-b]pyran-8-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H](C)C(=O)O[C@H]2[C@H](C)[C@@H](O)[C@H](C)O[C@@]21C |
| InChI | InChI=1S/C14H22O6/c1-6-10(16)8(3)20-14(5)11(6)19-13(17)7(2)12(14)18-9(4)15/h6-8,10-12,16H,1-5H3/t6-,7-,8+,10-,11+,12+,14+/m1/s1 |
| InChIKey | LWOSIIPXAIJGAY-XXVCXOIQSA-N |
| XLogP | 0.65 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |