About ethyl 2-(1-benzyl-5-ethyl-3,4-dihydro-2H-pyridin-4-yl)acetate
ethyl 2-(1-benzyl-5-ethyl-3,4-dihydro-2H-pyridin-4-yl)acetate (PubChem CID 11529370) has the molecular formula C18H25NO2
and a molecular weight of 287.40 g/mol. Its IUPAC name is ethyl 2-(1-benzyl-5-ethyl-3,4-dihydro-2H-pyridin-4-yl)acetate.
Molecular Properties
| Compound Name | ethyl 2-(1-benzyl-5-ethyl-3,4-dihydro-2H-pyridin-4-yl)acetate |
| PubChem CID | 11529370 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | ethyl 2-(1-benzyl-5-ethyl-3,4-dihydro-2H-pyridin-4-yl)acetate |
| SMILES | CCOC(=O)CC1CCN(Cc2ccccc2)C=C1CC |
| InChI | InChI=1S/C18H25NO2/c1-3-16-14-19(13-15-8-6-5-7-9-15)11-10-17(16)12-18(20)21-4-2/h5-9,14,17H,3-4,10-13H2,1-2H3 |
| InChIKey | BMWKKMPNUIHJFZ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2-(1-benzyl-5-ethyl-3,4-dihydro-2H-pyridin-4-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(1-benzyl-5-ethyl-3,4-dihydro-2H-pyridin-4-yl)acetate?
The IUPAC name of ethyl 2-(1-benzyl-5-ethyl-3,4-dihydro-2H-pyridin-4-yl)acetate (CID 11529370) is ethyl 2-(1-benzyl-5-ethyl-3,4-dihydro-2H-pyridin-4-yl)acetate.
What is the SMILES notation for ethyl 2-(1-benzyl-5-ethyl-3,4-dihydro-2H-pyridin-4-yl)acetate?
The canonical SMILES for ethyl 2-(1-benzyl-5-ethyl-3,4-dihydro-2H-pyridin-4-yl)acetate is CCOC(=O)CC1CCN(Cc2ccccc2)C=C1CC.
What is the InChIKey of ethyl 2-(1-benzyl-5-ethyl-3,4-dihydro-2H-pyridin-4-yl)acetate?
The InChIKey is BMWKKMPNUIHJFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25NO2/c1-3-16-14-19(13-15-8-6-5-7-9-15)11-10-17(16)12-18(20)21-4-2/h5-9,14,17H,3-4,10-13H2,1-2H3.
What are the key properties of ethyl 2-(1-benzyl-5-ethyl-3,4-dihydro-2H-pyridin-4-yl)acetate?
ethyl 2-(1-benzyl-5-ethyl-3,4-dihydro-2H-pyridin-4-yl)acetate has a molecular weight of 287.40 g/mol, XLogP of 3.76, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(1-benzyl-5-ethyl-3,4-dihydro-2H-pyridin-4-yl)acetate is sourced from PubChem (CID 11529370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).