About 2-chloro-4,6-bis(trifluoromethyl)-1H-benzimidazole
2-chloro-4,6-bis(trifluoromethyl)-1H-benzimidazole (PubChem CID 11529388) has the molecular formula C9H3ClF6N2
and a molecular weight of 288.58 g/mol. Its IUPAC name is 2-chloro-4,6-bis(trifluoromethyl)-1H-benzimidazole.
Molecular Properties
| Compound Name | 2-chloro-4,6-bis(trifluoromethyl)-1H-benzimidazole |
| PubChem CID | 11529388 |
| Molecular Formula | C9H3ClF6N2 |
| Molecular Weight | 288.58 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | 2-chloro-4,6-bis(trifluoromethyl)-1H-benzimidazole |
| SMILES | FC(F)(F)c1cc(C(F)(F)F)c2nc(Cl)[nH]c2c1 |
| InChI | InChI=1S/C9H3ClF6N2/c10-7-17-5-2-3(8(11,12)13)1-4(6(5)18-7)9(14,15)16/h1-2H,(H,17,18) |
| InChIKey | FVPXNCMEKAXLNJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.58 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-chloro-4,6-bis(trifluoromethyl)-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4,6-bis(trifluoromethyl)-1H-benzimidazole?
The IUPAC name of 2-chloro-4,6-bis(trifluoromethyl)-1H-benzimidazole (CID 11529388) is 2-chloro-4,6-bis(trifluoromethyl)-1H-benzimidazole.
What is the SMILES notation for 2-chloro-4,6-bis(trifluoromethyl)-1H-benzimidazole?
The canonical SMILES for 2-chloro-4,6-bis(trifluoromethyl)-1H-benzimidazole is FC(F)(F)c1cc(C(F)(F)F)c2nc(Cl)[nH]c2c1.
What is the InChIKey of 2-chloro-4,6-bis(trifluoromethyl)-1H-benzimidazole?
The InChIKey is FVPXNCMEKAXLNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H3ClF6N2/c10-7-17-5-2-3(8(11,12)13)1-4(6(5)18-7)9(14,15)16/h1-2H,(H,17,18).
What are the key properties of 2-chloro-4,6-bis(trifluoromethyl)-1H-benzimidazole?
2-chloro-4,6-bis(trifluoromethyl)-1H-benzimidazole has a molecular weight of 288.58 g/mol, XLogP of 4.25, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4,6-bis(trifluoromethyl)-1H-benzimidazole is sourced from PubChem (CID 11529388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).