C12H17N3O4S — CID 115294474
4-amino-N-(2-sulfamoylphenyl)oxane-4-carboxamide (PubChem CID 115294474) has the molecular formula C12H17N3O4S and a molecular weight of 299.35 g/mol. Its IUPAC name is 4-amino-N-(2-sulfamoylphenyl)oxane-4-carboxamide.
| Compound Name | 4-amino-N-(2-sulfamoylphenyl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 115294474 |
| Molecular Formula | C12H17N3O4S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 4-amino-N-(2-sulfamoylphenyl)oxane-4-carboxamide |
| SMILES | NC1(C(=O)Nc2ccccc2S(N)(=O)=O)CCOCC1 |
| InChI | InChI=1S/C12H17N3O4S/c13-12(5-7-19-8-6-12)11(16)15-9-3-1-2-4-10(9)20(14,17)18/h1-4H,5-8,13H2,(H,15,16)(H2,14,17,18) |
| InChIKey | RKODMGRHHQYPKS-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |