About N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)pentanamide
N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)pentanamide (PubChem CID 11529486) has the molecular formula C14H20N2O3S
and a molecular weight of 296.39 g/mol. Its IUPAC name is N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)pentanamide.
Molecular Properties
| Compound Name | N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)pentanamide |
| PubChem CID | 11529486 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)pentanamide |
| SMILES | CCCCC(=O)NC1Cc2ccc(S(N)(=O)=O)cc2C1 |
| InChI | InChI=1S/C14H20N2O3S/c1-2-3-4-14(17)16-12-7-10-5-6-13(20(15,18)19)9-11(10)8-12/h5-6,9,12H,2-4,7-8H2,1H3,(H,16,17)(H2,15,18,19) |
| InChIKey | VPKYLHQTQYEJLJ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)pentanamide?
The IUPAC name of N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)pentanamide (CID 11529486) is N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)pentanamide.
What is the SMILES notation for N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)pentanamide?
The canonical SMILES for N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)pentanamide is CCCCC(=O)NC1Cc2ccc(S(N)(=O)=O)cc2C1.
What is the InChIKey of N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)pentanamide?
The InChIKey is VPKYLHQTQYEJLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O3S/c1-2-3-4-14(17)16-12-7-10-5-6-13(20(15,18)19)9-11(10)8-12/h5-6,9,12H,2-4,7-8H2,1H3,(H,16,17)(H2,15,18,19).
What are the key properties of N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)pentanamide?
N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)pentanamide has a molecular weight of 296.39 g/mol, XLogP of 1.11, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)pentanamide is sourced from PubChem (CID 11529486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).