About 4-amino-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)oxane-4-carboxamide
4-amino-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)oxane-4-carboxamide (PubChem CID 115295047) has the molecular formula C12H13ClN4O2S
and a molecular weight of 312.78 g/mol. Its IUPAC name is 4-amino-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)oxane-4-carboxamide.
Molecular Properties
| Compound Name | 4-amino-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)oxane-4-carboxamide |
| PubChem CID | 115295047 |
| Molecular Formula | C12H13ClN4O2S |
| Molecular Weight | 312.78 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 4-amino-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)oxane-4-carboxamide |
| SMILES | NC1(C(=O)Nc2c(Cl)ccc3nsnc23)CCOCC1 |
| InChI | InChI=1S/C12H13ClN4O2S/c13-7-1-2-8-10(17-20-16-8)9(7)15-11(18)12(14)3-5-19-6-4-12/h1-2H,3-6,14H2,(H,15,18) |
| InChIKey | XKNPVOJDPCZWRP-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.78 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-amino-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)oxane-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)oxane-4-carboxamide?
The IUPAC name of 4-amino-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)oxane-4-carboxamide (CID 115295047) is 4-amino-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)oxane-4-carboxamide.
What is the SMILES notation for 4-amino-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)oxane-4-carboxamide?
The canonical SMILES for 4-amino-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)oxane-4-carboxamide is NC1(C(=O)Nc2c(Cl)ccc3nsnc23)CCOCC1.
What is the InChIKey of 4-amino-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)oxane-4-carboxamide?
The InChIKey is XKNPVOJDPCZWRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClN4O2S/c13-7-1-2-8-10(17-20-16-8)9(7)15-11(18)12(14)3-5-19-6-4-12/h1-2H,3-6,14H2,(H,15,18).
What are the key properties of 4-amino-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)oxane-4-carboxamide?
4-amino-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)oxane-4-carboxamide has a molecular weight of 312.78 g/mol, XLogP of 1.79, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)oxane-4-carboxamide is sourced from PubChem (CID 115295047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).