C13H17BrN2O4S — CID 115295978
2-bromo-5-[(4-methylpiperidin-1-yl)sulfonylamino]benzoic acid (PubChem CID 115295978) has the molecular formula C13H17BrN2O4S and a molecular weight of 377.26 g/mol. Its IUPAC name is 2-bromo-5-[(4-methylpiperidin-1-yl)sulfonylamino]benzoic acid.
| Compound Name | 2-bromo-5-[(4-methylpiperidin-1-yl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 115295978 |
| Molecular Formula | C13H17BrN2O4S |
| Molecular Weight | 377.26 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | 2-bromo-5-[(4-methylpiperidin-1-yl)sulfonylamino]benzoic acid |
| SMILES | CC1CCN(S(=O)(=O)Nc2ccc(Br)c(C(=O)O)c2)CC1 |
| InChI | InChI=1S/C13H17BrN2O4S/c1-9-4-6-16(7-5-9)21(19,20)15-10-2-3-12(14)11(8-10)13(17)18/h2-3,8-9,15H,4-7H2,1H3,(H,17,18) |
| InChIKey | XYYPYDDXLMNUGI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |