C13H14BrN3O4 — CID 115296951
2-bromo-5-[(4-methyl-3-oxopiperazine-1-carbonyl)amino]benzoic acid (PubChem CID 115296951) has the molecular formula C13H14BrN3O4 and a molecular weight of 356.18 g/mol. Its IUPAC name is 2-bromo-5-[(4-methyl-3-oxopiperazine-1-carbonyl)amino]benzoic acid.
| Compound Name | 2-bromo-5-[(4-methyl-3-oxopiperazine-1-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 115296951 |
| Molecular Formula | C13H14BrN3O4 |
| Molecular Weight | 356.18 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | 2-bromo-5-[(4-methyl-3-oxopiperazine-1-carbonyl)amino]benzoic acid |
| SMILES | CN1CCN(C(=O)Nc2ccc(Br)c(C(=O)O)c2)CC1=O |
| InChI | InChI=1S/C13H14BrN3O4/c1-16-4-5-17(7-11(16)18)13(21)15-8-2-3-10(14)9(6-8)12(19)20/h2-3,6H,4-5,7H2,1H3,(H,15,21)(H,19,20) |
| InChIKey | GCHZKNFFGZIBGF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.18 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |