C14H16O6S — CID 11529707
[(1S,2S,4R,5R)-2-methyl-3-oxo-6,8-dioxabicyclo[3.2.1]octan-4-yl] 4-methylbenzenesulfonate (PubChem CID 11529707) has the molecular formula C14H16O6S and a molecular weight of 312.34 g/mol. Its IUPAC name is [(1S,2S,4R,5R)-2-methyl-3-oxo-6,8-dioxabicyclo[3.2.1]octan-4-yl] 4-methylbenzenesulfonate.
| Compound Name | [(1S,2S,4R,5R)-2-methyl-3-oxo-6,8-dioxabicyclo[3.2.1]octan-4-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11529707 |
| Molecular Formula | C14H16O6S |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | [(1S,2S,4R,5R)-2-methyl-3-oxo-6,8-dioxabicyclo[3.2.1]octan-4-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2C(=O)[C@@H](C)[C@H]3CO[C@@H]2O3)cc1 |
| InChI | InChI=1S/C14H16O6S/c1-8-3-5-10(6-4-8)21(16,17)20-13-12(15)9(2)11-7-18-14(13)19-11/h3-6,9,11,13-14H,7H2,1-2H3/t9-,11+,13-,14+/m0/s1 |
| InChIKey | XJKIIVXRNFDLTL-PCGAWMICSA-N |
| XLogP | 1.03 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|