C13H17BrN2O3 — CID 115297303
(2R)-2-[(5-amino-2-bromobenzoyl)amino]-4-methylpentanoic acid (PubChem CID 115297303) has the molecular formula C13H17BrN2O3 and a molecular weight of 329.19 g/mol. Its IUPAC name is (2R)-2-[(5-amino-2-bromobenzoyl)amino]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[(5-amino-2-bromobenzoyl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 115297303 |
| Molecular Formula | C13H17BrN2O3 |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | (2R)-2-[(5-amino-2-bromobenzoyl)amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@@H](NC(=O)c1cc(N)ccc1Br)C(=O)O |
| InChI | InChI=1S/C13H17BrN2O3/c1-7(2)5-11(13(18)19)16-12(17)9-6-8(15)3-4-10(9)14/h3-4,6-7,11H,5,15H2,1-2H3,(H,16,17)(H,18,19)/t11-/m1/s1 |
| InChIKey | SJRAIXBBJCSLBS-LLVKDONJSA-N |
| XLogP | 2.26 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|