C15H21BrN2O3 — CID 115297367
6-[(5-amino-2-bromobenzoyl)amino]-4-ethylhexanoic acid (PubChem CID 115297367) has the molecular formula C15H21BrN2O3 and a molecular weight of 357.25 g/mol. Its IUPAC name is 6-[(5-amino-2-bromobenzoyl)amino]-4-ethylhexanoic acid.
| Compound Name | 6-[(5-amino-2-bromobenzoyl)amino]-4-ethylhexanoic acid |
|---|---|
| PubChem CID | 115297367 |
| Molecular Formula | C15H21BrN2O3 |
| Molecular Weight | 357.25 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 6-[(5-amino-2-bromobenzoyl)amino]-4-ethylhexanoic acid |
| SMILES | CCC(CCNC(=O)c1cc(N)ccc1Br)CCC(=O)O |
| InChI | InChI=1S/C15H21BrN2O3/c1-2-10(3-6-14(19)20)7-8-18-15(21)12-9-11(17)4-5-13(12)16/h4-5,9-10H,2-3,6-8,17H2,1H3,(H,18,21)(H,19,20) |
| InChIKey | IDFVWCWZFOJIQH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.25 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|