C16H19BrN2 — CID 115297680
4-bromo-3-[(N,3,5-trimethylanilino)methyl]aniline (PubChem CID 115297680) has the molecular formula C16H19BrN2 and a molecular weight of 319.25 g/mol. Its IUPAC name is 4-bromo-3-[(N,3,5-trimethylanilino)methyl]aniline.
| Compound Name | 4-bromo-3-[(N,3,5-trimethylanilino)methyl]aniline |
|---|---|
| PubChem CID | 115297680 |
| Molecular Formula | C16H19BrN2 |
| Molecular Weight | 319.25 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 4-bromo-3-[(N,3,5-trimethylanilino)methyl]aniline |
| SMILES | Cc1cc(C)cc(N(C)Cc2cc(N)ccc2Br)c1 |
| InChI | InChI=1S/C16H19BrN2/c1-11-6-12(2)8-15(7-11)19(3)10-13-9-14(18)4-5-16(13)17/h4-9H,10,18H2,1-3H3 |
| InChIKey | AKVNZVITKTVMMG-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.25 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|