C9H14N4Na2O2S2 — CID 11529840
disodium;(1Z,3Z)-N,N'-di(ethanethioyl)-N,N'-dimethylpropanedihydrazonate (PubChem CID 11529840) has the molecular formula C9H14N4Na2O2S2 and a molecular weight of 320.35 g/mol. Its IUPAC name is disodium;(1Z,3Z)-N,N'-di(ethanethioyl)-N,N'-dimethylpropanedihydrazonate.
| Compound Name | disodium;(1Z,3Z)-N,N'-di(ethanethioyl)-N,N'-dimethylpropanedihydrazonate |
|---|---|
| PubChem CID | 11529840 |
| Molecular Formula | C9H14N4Na2O2S2 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | disodium;(1Z,3Z)-N,N'-di(ethanethioyl)-N,N'-dimethylpropanedihydrazonate |
| SMILES | CC(=S)N(C)/N=C(\[O-])C/C([O-])=N/N(C)C(C)=S.[Na+].[Na+] |
| InChI | InChI=1S/C9H16N4O2S2.2Na/c1-6(16)12(3)10-8(14)5-9(15)11-13(4)7(2)17;;/h5H2,1-4H3,(H,10,14)(H,11,15);;/q;2*+1/p-2 |
| InChIKey | VLBRMMNQPCUOBU-UHFFFAOYSA-L |
| XLogP | -6.71 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | -6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|