About [5-(benzenesulfonyl)-5,5-difluoropentyl]benzene
[5-(benzenesulfonyl)-5,5-difluoropentyl]benzene (PubChem CID 11529906) has the molecular formula C17H18F2O2S
and a molecular weight of 324.39 g/mol. Its IUPAC name is [5-(benzenesulfonyl)-5,5-difluoropentyl]benzene.
Molecular Properties
| Compound Name | [5-(benzenesulfonyl)-5,5-difluoropentyl]benzene |
| PubChem CID | 11529906 |
| Molecular Formula | C17H18F2O2S |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | [5-(benzenesulfonyl)-5,5-difluoropentyl]benzene |
| SMILES | O=S(=O)(c1ccccc1)C(F)(F)CCCCc1ccccc1 |
| InChI | InChI=1S/C17H18F2O2S/c18-17(19,22(20,21)16-12-5-2-6-13-16)14-8-7-11-15-9-3-1-4-10-15/h1-6,9-10,12-13H,7-8,11,14H2 |
| InChIKey | LXGDECBBCIYQFU-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [5-(benzenesulfonyl)-5,5-difluoropentyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(benzenesulfonyl)-5,5-difluoropentyl]benzene?
The IUPAC name of [5-(benzenesulfonyl)-5,5-difluoropentyl]benzene (CID 11529906) is [5-(benzenesulfonyl)-5,5-difluoropentyl]benzene.
What is the SMILES notation for [5-(benzenesulfonyl)-5,5-difluoropentyl]benzene?
The canonical SMILES for [5-(benzenesulfonyl)-5,5-difluoropentyl]benzene is O=S(=O)(c1ccccc1)C(F)(F)CCCCc1ccccc1.
What is the InChIKey of [5-(benzenesulfonyl)-5,5-difluoropentyl]benzene?
The InChIKey is LXGDECBBCIYQFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18F2O2S/c18-17(19,22(20,21)16-12-5-2-6-13-16)14-8-7-11-15-9-3-1-4-10-15/h1-6,9-10,12-13H,7-8,11,14H2.
What are the key properties of [5-(benzenesulfonyl)-5,5-difluoropentyl]benzene?
[5-(benzenesulfonyl)-5,5-difluoropentyl]benzene has a molecular weight of 324.39 g/mol, XLogP of 4.47, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(benzenesulfonyl)-5,5-difluoropentyl]benzene is sourced from PubChem (CID 11529906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).