C11H13FN2O2 — CID 115299654
(3-amino-3-methylazetidin-1-yl)-(5-fluoro-2-hydroxyphenyl)methanone (PubChem CID 115299654) has the molecular formula C11H13FN2O2 and a molecular weight of 224.24 g/mol. Its IUPAC name is (3-amino-3-methylazetidin-1-yl)-(5-fluoro-2-hydroxyphenyl)methanone.
| Compound Name | (3-amino-3-methylazetidin-1-yl)-(5-fluoro-2-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 115299654 |
| Molecular Formula | C11H13FN2O2 |
| Molecular Weight | 224.24 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | (3-amino-3-methylazetidin-1-yl)-(5-fluoro-2-hydroxyphenyl)methanone |
| SMILES | CC1(N)CN(C(=O)c2cc(F)ccc2O)C1 |
| InChI | InChI=1S/C11H13FN2O2/c1-11(13)5-14(6-11)10(16)8-4-7(12)2-3-9(8)15/h2-4,15H,5-6,13H2,1H3 |
| InChIKey | UWZPAJDIFYOGBY-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.24 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |