C11H20N4O — CID 115300045
2-[4-[[3-(methylamino)pyrrolidin-1-yl]methyl]pyrazol-1-yl]ethanol (PubChem CID 115300045) has the molecular formula C11H20N4O and a molecular weight of 224.31 g/mol. Its IUPAC name is 2-[4-[[3-(methylamino)pyrrolidin-1-yl]methyl]pyrazol-1-yl]ethanol.
| Compound Name | 2-[4-[[3-(methylamino)pyrrolidin-1-yl]methyl]pyrazol-1-yl]ethanol |
|---|---|
| PubChem CID | 115300045 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 2-[4-[[3-(methylamino)pyrrolidin-1-yl]methyl]pyrazol-1-yl]ethanol |
| SMILES | CNC1CCN(Cc2cnn(CCO)c2)C1 |
| InChI | InChI=1S/C11H20N4O/c1-12-11-2-3-14(9-11)7-10-6-13-15(8-10)4-5-16/h6,8,11-12,16H,2-5,7,9H2,1H3 |
| InChIKey | BINKOSCVCKQHDL-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |